ChemNet > CAS > 604-44-4 4-Chloro-1-naphthol
604-44-4 4-Chloro-1-naphthol
| product Name |
4-Chloro-1-naphthol |
| CAS No |
604-44-4 |
| Synonyms |
1-Chloro-4-hydroxynaphthalene; 4-Chloro-alpha-naphthol; NSC 44345; 1-Naphthalenol, 4-chloro-; 1-Naphthol, 4-chloro- (8CI); 4-chloronaphthalen-1-ol |
| Molecular Formula |
C10H7ClO |
| Molecular Weight |
178.615 |
| InChI |
InChI=1/C10H7ClO/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6,12H |
| EINECS |
210-068-5 |
| Molecular Structure |
|
| Density |
1.333g/cm3 |
| Melting point |
117-120℃ |
| Boiling point |
332.1°C at 760 mmHg |
| Refractive index |
1.684 |
| Flash point |
154.6°C |
| Vapour Pressur |
7.74E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
