ChemNet > CAS > 604-59-1 Alpha-Naphthoflavone
604-59-1 Alpha-Naphthoflavone
| product Name |
Alpha-Naphthoflavone |
| CAS No |
604-59-1 |
| Synonyms |
7,8-Benzoflavone; 2-phenylbenzo(h)chromen-4-one; 2-phenyl-4H-benzo[h]chromen-4-one |
| Molecular Formula |
C19H12O2 |
| Molecular Weight |
272.2974 |
| InChI |
InChI=1/C19H12O2/c20-17-12-18(14-7-2-1-3-8-14)21-19-15-9-5-4-6-13(15)10-11-16(17)19/h1-12H |
| EINECS |
210-071-1 |
| Molecular Structure |
|
| Density |
1.276g/cm3 |
| Melting point |
155-157℃ |
| Boiling point |
460.9°C at 760 mmHg |
| Refractive index |
1.695 |
| Flash point |
215.8°C |
| Vapour Pressur |
1.12E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
