ChemNet > CAS > 60404-18-4 3-Bromo-2,5-dichlorothiophene
60404-18-4 3-Bromo-2,5-dichlorothiophene
| product Name |
3-Bromo-2,5-dichlorothiophene |
| CAS No |
60404-18-4 |
| Molecular Formula |
C4HBrCl2S |
| Molecular Weight |
231.9257 |
| InChI |
InChI=1/C4HBrCl2S/c5-2-1-3(6)8-4(2)7/h1H |
| Molecular Structure |
|
| Density |
1.949g/cm3 |
| Boiling point |
223.1°C at 760 mmHg |
| Refractive index |
1.625 |
| Flash point |
88.7°C |
| Vapour Pressur |
0.146mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
