ChemNet > CAS > 605-02-7 1-Phenylnaphthalene
605-02-7 1-Phenylnaphthalene
| product Name |
1-Phenylnaphthalene |
| CAS No |
605-02-7 |
| Synonyms |
NSC 5257; Naphthalene, 1-phenyl-; Naphthalene, 1-phenyl- (8CI)(9CI) |
| Molecular Formula |
C16H12 |
| Molecular Weight |
204.2665 |
| InChI |
InChI=1/C16H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-12H |
| EINECS |
210-081-6 |
| Molecular Structure |
|
| Density |
1.081g/cm3 |
| Boiling point |
336.4°C at 760 mmHg |
| Refractive index |
1.647 |
| Flash point |
148.2°C |
| Vapour Pressur |
0.000219mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
