ChemNet > CAS > 605-62-9 4-Nitro-1-Naphthol
605-62-9 4-Nitro-1-Naphthol
| product Name |
4-Nitro-1-Naphthol |
| CAS No |
605-62-9 |
| Synonyms |
4-nitronaphthalen-1-ol |
| Molecular Formula |
C10H7NO3 |
| Molecular Weight |
189.1675 |
| InChI |
InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
| Molecular Structure |
|
| Density |
1.413g/cm3 |
| Boiling point |
398.8°C at 760 mmHg |
| Refractive index |
1.714 |
| Flash point |
179.8°C |
| Vapour Pressur |
6.25E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
