ChemNet > CAS > 6051-87-2 Beta-Naphthoflavone
6051-87-2 Beta-Naphthoflavone
| product Name |
Beta-Naphthoflavone |
| CAS No |
6051-87-2 |
| Synonyms |
5,6-Benzoflavone; 3-phenyl-1H-benzo[f]chromen-1-one; β-Naphthoflavone |
| Molecular Formula |
C19H12O2 |
| Molecular Weight |
272.2974 |
| InChI |
InChI=1/C19H12O2/c20-16-12-18(14-7-2-1-3-8-14)21-17-11-10-13-6-4-5-9-15(13)19(16)17/h1-12H |
| EINECS |
227-958-4 |
| Molecular Structure |
|
| Density |
1.276g/cm3 |
| Melting point |
162-164℃ |
| Boiling point |
460.9°C at 760 mmHg |
| Refractive index |
1.695 |
| Flash point |
215.8°C |
| Vapour Pressur |
1.12E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
