ChemNet > CAS > 606-43-9 N-Methylcarbostyril
606-43-9 N-Methylcarbostyril
| product Name |
N-Methylcarbostyril |
| CAS No |
606-43-9 |
| Synonyms |
2-Hydroxy-1-methylquinoline; N-Methylcarbostyril; 1-methylquinolin-2(1H)-one; 1-methyl-2-Quinolinone |
| Molecular Formula |
C10H9NO |
| Molecular Weight |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-11-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3 |
| Molecular Structure |
|
| Density |
1.16g/cm3 |
| Boiling point |
247.5°C at 760 mmHg |
| Refractive index |
1.592 |
| Flash point |
106.8°C |
| Vapour Pressur |
0.0255mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
