ChemNet > CAS > 608-05-9 5-methylisatin
608-05-9 5-methylisatin
| product Name |
5-methylisatin |
| CAS No |
608-05-9 |
| Synonyms |
5-methylindole-2,3(1H)-dione; 5-methyl-1H-indole-2,3-dione |
| Molecular Formula |
C9H7NO2 |
| Molecular Weight |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-5-2-3-7-6(4-5)8(11)9(12)10-7/h2-4H,1H3,(H,10,11,12) |
| EINECS |
210-152-1 |
| Molecular Structure |
|
| Density |
1.301g/cm3 |
| Melting point |
180℃ (dec.) |
| Refractive index |
1.598 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
