ChemNet > CAS > 608-08-2 Indoxyl acetate
608-08-2 Indoxyl acetate
| product Name |
Indoxyl acetate |
| CAS No |
608-08-2 |
| Synonyms |
3-Acetoxyindole~Indolyl acetate~Y-acetate; Indoxyl acetate 3-Indoxyl acetate; 3-Indolyl acetate; 3-Acetoxyindole; 1H-indol-3-yl acetate |
| Molecular Formula |
C10H9NO2 |
| Molecular Weight |
175.184 |
| InChI |
InChI=1/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 |
| EINECS |
210-154-2 |
| Molecular Structure |
|
| Density |
1.255g/cm3 |
| Melting point |
128-131℃ |
| Boiling point |
339.1°C at 760 mmHg |
| Refractive index |
1.633 |
| Flash point |
158.9°C |
| Vapour Pressur |
9.41E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
