ChemNet > CAS > 526-78-3 2,3-Dibromosuccinic acid
526-78-3 2,3-Dibromosuccinic acid
| product Name |
2,3-Dibromosuccinic acid |
| CAS No |
526-78-3;608-35-5;608-36-6 |
| Synonyms |
Dibromosuccinicacid; 2,3-Dibromosucinic Acid; 2,3-Dibromo Dibutyric Acid; meso-2,3-Dibromosuccinic acid; (2R,3S)-2,3-dibromobutanedioic acid; (2R,3S)-2,3-dibromobutanedioate |
| Molecular Formula |
C4H2Br2O4 |
| Molecular Weight |
273.8654 |
| InChI |
InChI=1/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/p-2/t1-,2+ |
| EINECS |
208-396-9 |
| Molecular Structure |
|
| Melting point |
255-260℃ |
| Boiling point |
262.4°C at 760 mmHg |
| Flash point |
112.5°C |
| Water solubility |
20 g/L (17℃) |
| Vapour Pressur |
0.00323mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
