ChemNet > CAS > 6094-60-6 1-Benzyl-4-cyano-4-hydroxypiperidine
6094-60-6 1-Benzyl-4-cyano-4-hydroxypiperidine
| product Name |
1-Benzyl-4-cyano-4-hydroxypiperidine |
| CAS No |
6094-60-6 |
| Molecular Formula |
C13H16N2O |
| Molecular Weight |
216.2789 |
| InChI |
InChI=1/C13H16N2O/c14-11-13(16)6-8-15(9-7-13)10-12-4-2-1-3-5-12/h1-5,16H,6-10H2 |
| EINECS |
228-043-2 |
| Molecular Structure |
|
| Density |
1.17g/cm3 |
| Melting point |
90-95℃ |
| Boiling point |
399.5°C at 760 mmHg |
| Refractive index |
1.592 |
| Flash point |
195.4°C |
| Vapour Pressur |
4.22E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
