ChemNet > CAS > 610-28-6 2,5-dinitrobenzoic acid
610-28-6 2,5-dinitrobenzoic acid
| product Name |
2,5-dinitrobenzoic acid |
| CAS No |
610-28-6 |
| Synonyms |
2,5-Dinitrobenzoic acid; 4-09-00-01241 (Beilstein Handbook Reference); BRN 1983247; CCRIS 3127; NSC 3810; Benzoic acid, 2,5-dinitro-; 2,5-dinitrobenzoate |
| Molecular Formula |
C7H3N2O6 |
| Molecular Weight |
211.1091 |
| InChI |
InChI=1/C7H4N2O6/c10-7(11)5-3-4(8(12)13)1-2-6(5)9(14)15/h1-3H,(H,10,11)/p-1 |
| EINECS |
210-216-9 |
| Molecular Structure |
|
| Melting point |
180℃ |
| Boiling point |
419.6°C at 760 mmHg |
| Flash point |
190.5°C |
| Vapour Pressur |
8.59E-08mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
