ChemNet > CAS > 61020-07-3 N-Formyl-2-methoxy-piperidine
61020-07-3 N-Formyl-2-methoxy-piperidine
| product Name |
N-Formyl-2-methoxy-piperidine |
| CAS No |
61020-07-3 |
| Synonyms |
2-Methoxypiperidine-1-carboxaldehyde; N-formyl-2-methoxypiperidine; (2R)-2-methoxypiperidine-1-carbaldehyde; 2-methoxypiperidine-1-carbaldehyde; (2S)-2-methoxypiperidine-1-carbaldehyde |
| Molecular Formula |
C7H13NO2 |
| Molecular Weight |
143.1836 |
| InChI |
InChI=1/C7H13NO2/c1-10-7-4-2-3-5-8(7)6-9/h6-7H,2-5H2,1H3/t7-/m0/s1 |
| Molecular Structure |
|
| Density |
1.04g/cm3 |
| Boiling point |
252.1°C at 760 mmHg |
| Refractive index |
1.473 |
| Flash point |
98.9°C |
| Vapour Pressur |
0.0197mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
