ChemNet > CAS > 61040-81-1 3,5-Dimethoxy-4-methylbenzoic acid
61040-81-1 3,5-Dimethoxy-4-methylbenzoic acid
| product Name |
3,5-Dimethoxy-4-methylbenzoic acid |
| CAS No |
61040-81-1 |
| Synonyms |
3,5-Dimethoxy-p-toluic acid (COOH=1) |
| Molecular Formula |
C10H12O4 |
| Molecular Weight |
196.1999 |
| InChI |
InChI=1/C10H12O4/c1-6-8(13-2)4-7(10(11)12)5-9(6)14-3/h4-5H,1-3H3,(H,11,12) |
| Molecular Structure |
|
| Density |
1.18g/cm3 |
| Melting point |
211-216℃ |
| Boiling point |
347.7°C at 760 mmHg |
| Refractive index |
1.53 |
| Flash point |
137.8°C |
| Vapour Pressur |
1.99E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
