| product Name |
2,3,4-Trifluorobenzoic acid |
| Synonyms |
2,3,4-3-Fluorobenzoic acid; RARECHEM AL BO 0257; TIMTEC-BB SBB006557; BUTTPARK 30\01-45; 2,3,4-trifluorobenzoic acid and derivatives; 2,3,4-TRIFLUOROBENZOIC ACID THE DERIVATIVES; 2,3,4-Trifluorobenzoic; 2,3,4-Trifluorobenzoic acid 98%; 2-bromo-2,3,3,3-tetrafluoropropanoyl fluoride; 2,3,4-trifiuorobenzoic acid; 2,3,4-trifluorobenzoate |
| Molecular Formula |
C7H2F3O2 |
| Molecular Weight |
175.0853 |
| InChI |
InChI=1/C7H3F3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H,11,12)/p-1 |
| CAS Registry Number |
61079-72-9 |
| Molecular Structure |
|
| Melting point |
139-143℃ |
| Boiling point |
245.3°C at 760 mmHg |
| Flash point |
102.1°C |
| Vapour Pressur |
0.0155mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
| MSDS |
2,3,4-Trifluorobenzoic acid Material Safety Data Sheet
|
|
