ChemNet > CAS > 6118-51-0 exo-3,6-Epoxy-1,2,3,6-tetrahydrophthalic anhydride
6118-51-0 exo-3,6-Epoxy-1,2,3,6-tetrahydrophthalic anhydride
| product Name |
exo-3,6-Epoxy-1,2,3,6-tetrahydrophthalic anhydride |
| CAS No |
6118-51-0 |
| Synonyms |
5,6-Dehydronorcantharidin; exo-7-Oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic anhydride; (3aR,4S,7R,7aS)-3a,4,7,7a-tetrahydro-4,7-epoxy-2-benzofuran-1,3-dione |
| Molecular Formula |
C8H6O4 |
| Molecular Weight |
166.1308 |
| InChI |
InChI=1/C8H6O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h1-6H/t3-,4+,5-,6+ |
| Molecular Structure |
|
| Density |
1.54g/cm3 |
| Melting point |
118℃ |
| Boiling point |
372°C at 760 mmHg |
| Refractive index |
1.583 |
| Flash point |
172.3°C |
| Vapour Pressur |
9.91E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
