ChemNet > CAS > 61226-19-5 3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid
61226-19-5 3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid
| product Name |
3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid |
| CAS No |
61226-19-5 |
| Synonyms |
3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylate |
| Molecular Formula |
C12H11N2O2 |
| Molecular Weight |
215.2285 |
| InChI |
InChI=1/C12H12N2O2/c1-8-11(12(15)16)9(2)14(13-8)10-6-4-3-5-7-10/h3-7H,1-2H3,(H,15,16)/p-1 |
| Molecular Structure |
|
| Melting point |
202℃ |
| Boiling point |
387.7°C at 760 mmHg |
| Flash point |
188.2°C |
| Vapour Pressur |
1.05E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
