ChemNet > CAS > 61259-29-8 1-cyclohexyl-2-phenyl-1-ethanone
61259-29-8 1-cyclohexyl-2-phenyl-1-ethanone
| product Name |
1-cyclohexyl-2-phenyl-1-ethanone |
| CAS No |
61259-29-8 |
| Synonyms |
1-cyclohexyl-2-phenylethanone |
| Molecular Formula |
C14H18O |
| Molecular Weight |
202.2921 |
| InChI |
InChI=1/C14H18O/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1,3-4,7-8,13H,2,5-6,9-11H2 |
| Molecular Structure |
|
| Density |
1.019g/cm3 |
| Boiling point |
309.1°C at 760 mmHg |
| Refractive index |
1.53 |
| Flash point |
129.4°C |
| Vapour Pressur |
0.000653mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
