ChemNet > CAS > 61277-90-5 (2R)-(+)-endo-Norborneol
61277-90-5 (2R)-(+)-endo-Norborneol
| product Name |
(2R)-(+)-endo-Norborneol |
| CAS No |
61277-90-5 |
| Synonyms |
(1S,2R,4R)-Bicyclo[2.2.1]heptan-2-ol; (+)-endo-2-Norborneol; (1S,2R,4R)-(+)-endo-Norborneol |
| Molecular Formula |
C7H12O |
| Molecular Weight |
112.1696 |
| InChI |
InChI=1/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2/t5-,6+,7-/m1/s1 |
| Molecular Structure |
|
| Density |
1.098g/cm3 |
| Melting point |
149-154℃ |
| Boiling point |
176.499°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
74.376°C |
| Vapour Pressur |
0.332mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
