ChemNet > CAS > 613-54-7 alpha-Bromo-2'-acetonaphthone
613-54-7 alpha-Bromo-2'-acetonaphthone
| product Name |
alpha-Bromo-2'-acetonaphthone |
| CAS No |
613-54-7 |
| Synonyms |
Bromomethyl 2-naphthyl ketone; alpha-Bromo-2-acetonaphthone; 2-(Bromoacetyl)naphthalene; 2-(Bromoacetyl)naphthalene; 2-bromo-1-(naphthalen-2-yl)ethanone; α-Bromo-2-acetonaphthone; 2-Bromo-2'-acetonaphthone; 2-Bromo-1-(2-naphthyl)-1-ethanone |
| Molecular Formula |
C12H9BrO |
| Molecular Weight |
249.1033 |
| InChI |
InChI=1/C12H9BrO/c13-8-12(14)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2 |
| EINECS |
210-348-7 |
| Molecular Structure |
|
| Density |
1.48g/cm3 |
| Melting point |
82-85℃ |
| Boiling point |
349.8°C at 760 mmHg |
| Refractive index |
1.656 |
| Flash point |
99.1°C |
| Vapour Pressur |
4.59E-05mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
