ChemNet > CAS > 6135-31-5 Methyl N-ethylcarbamate
6135-31-5 Methyl N-ethylcarbamate
| product Name |
Methyl N-ethylcarbamate |
| CAS No |
6135-31-5 |
| Synonyms |
N-Ethylcarbamic acid methyl ester; methyl ethylcarbamate |
| Molecular Formula |
C4H9NO2 |
| Molecular Weight |
103.1198 |
| InChI |
InChI=1/C4H9NO2/c1-3-5-4(6)7-2/h3H2,1-2H3,(H,5,6) |
| Molecular Structure |
|
| Density |
0.964g/cm3 |
| Boiling point |
172°C at 760 mmHg |
| Refractive index |
1.4 |
| Flash point |
57.8°C |
| Vapour Pressur |
1.36mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
