ChemNet > CAS > 616-04-6 1-Methylhydantoin
616-04-6 1-Methylhydantoin
| product Name |
1-Methylhydantoin |
| CAS No |
616-04-6 |
| Synonyms |
1-methylimidazolidine-2,4-dione; 3-methylimidazolidine-2,4-dione |
| Molecular Formula |
C4H6N2O2 |
| Molecular Weight |
114.1026 |
| InChI |
InChI=1/C4H6N2O2/c1-6-3(7)2-5-4(6)8/h2H2,1H3,(H,5,8) |
| EINECS |
210-460-6 |
| Molecular Structure |
|
| Density |
1.285g/cm3 |
| Melting point |
156-160℃ |
| Refractive index |
1.491 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
