ChemNet > CAS > 617-05-0 Vanilicacidethylester; 97%
617-05-0 Vanilicacidethylester; 97%
| product Name |
Vanilicacidethylester; 97% |
| CAS No |
617-05-0 |
| Synonyms |
Vanilic acid ethyl ester; Ethyl vanillate; Ethyl 4-hydroxy-3-methoxybenzoate~Vanillic acid ethyl ester; 4-Hydroxy-3-methoxybenzoic acid ethyl ester; ethyl 4-hydroxy-3-methoxybenzoate |
| Molecular Formula |
C10H12O4 |
| Molecular Weight |
196.1999 |
| InChI |
InChI=1/C10H12O4/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6,11H,3H2,1-2H3 |
| EINECS |
210-503-9 |
| Molecular Structure |
|
| Density |
1.18g/cm3 |
| Melting point |
39-41℃ |
| Boiling point |
292°C at 760 mmHg |
| Refractive index |
1.528 |
| Flash point |
122.4°C |
| Vapour Pressur |
0.00108mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
