ChemNet > CAS > 618-71-3 Ethyl 3,5-dinitrobenzoate
618-71-3 Ethyl 3,5-dinitrobenzoate
| product Name |
Ethyl 3,5-dinitrobenzoate |
| CAS No |
618-71-3 |
| Synonyms |
3,5-Dinitrobenzoic acid ethyl ester |
| Molecular Formula |
C9H8N2O6 |
| Molecular Weight |
240.1696 |
| InChI |
InChI=1/C9H8N2O6/c1-2-17-9(12)6-3-7(10(13)14)5-8(4-6)11(15)16/h3-5H,2H2,1H3 |
| EINECS |
210-559-4 |
| Molecular Structure |
|
| Density |
1.433g/cm3 |
| Melting point |
94-95℃ |
| Boiling point |
367.1°C at 760 mmHg |
| Refractive index |
1.58 |
| Flash point |
171.8°C |
| Vapour Pressur |
1.39E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
