ChemNet > CAS > 6214-44-4 4-Ethoxybenzyl alcohol
6214-44-4 4-Ethoxybenzyl alcohol
| product Name |
4-Ethoxybenzyl alcohol |
| CAS No |
6214-44-4 |
| Synonyms |
AI3-05517; Benzenemethanol, 4-ethoxy-; (4-ethoxyphenyl)methanol |
| Molecular Formula |
C9H12O2 |
| Molecular Weight |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6,10H,2,7H2,1H3 |
| EINECS |
228-283-8 |
| Molecular Structure |
|
| Density |
1.058g/cm3 |
| Melting point |
27-32℃ |
| Boiling point |
273°C at 760 mmHg |
| Refractive index |
1.524 |
| Flash point |
114.4°C |
| Vapour Pressur |
0.00287mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
