ChemNet > CAS > 623-76-7 1,3-diethylurea
623-76-7 1,3-diethylurea
| product Name |
1,3-diethylurea |
| CAS No |
623-76-7 |
| Synonyms |
N,N-Diethylurea; Diethylurea symmetrical; N,N'-Diethylurea |
| Molecular Formula |
C5H12N2O |
| Molecular Weight |
116.1616 |
| InChI |
InChI=1/C5H12N2O/c1-3-6-5(8)7-4-2/h3-4H2,1-2H3,(H2,6,7,8) |
| EINECS |
210-811-3 |
| Molecular Structure |
|
| Density |
0.923g/cm3 |
| Melting point |
112-113℃ |
| Boiling point |
263°C at 760 mmHg |
| Refractive index |
1.428 |
| Flash point |
121.1°C |
| Vapour Pressur |
0.0106mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
