ChemNet > CAS > 623-82-5 (+)-3-Methyladipic acid
623-82-5 (+)-3-Methyladipic acid
| product Name |
(+)-3-Methyladipic acid |
| CAS No |
623-82-5 |
| Synonyms |
Methylhexanedioic acid; (3R)-3-methylhexanedioic acid; (3R)-3-methylhexanedioate |
| Molecular Formula |
C7H10O4 |
| Molecular Weight |
158.153 |
| InChI |
InChI=1/C7H12O4/c1-5(4-7(10)11)2-3-6(8)9/h5H,2-4H2,1H3,(H,8,9)(H,10,11)/p-2/t5-/m1/s1 |
| EINECS |
210-816-0 |
| Molecular Structure |
|
| Melting point |
81-84℃ |
| Boiling point |
341.4°C at 760 mmHg |
| Flash point |
170.6°C |
| Vapour Pressur |
1.47E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
