ChemNet > CAS > 62373-80-2 3-(4-Methoxyphenoxy)benzaldehyde
62373-80-2 3-(4-Methoxyphenoxy)benzaldehyde
| product Name |
3-(4-Methoxyphenoxy)benzaldehyde |
| CAS No |
62373-80-2 |
| Molecular Formula |
C14H12O3 |
| Molecular Weight |
228.2433 |
| InChI |
InChI=1/C14H12O3/c1-16-12-5-7-13(8-6-12)17-14-4-2-3-11(9-14)10-15/h2-10H,1H3 |
| EINECS |
263-527-7 |
| Molecular Structure |
|
| Density |
1.166g/cm3 |
| Boiling point |
367.1°C at 760 mmHg |
| Refractive index |
1.59 |
| Flash point |
172.1°C |
| Vapour Pressur |
1.4E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
