ChemNet > CAS > 625-38-7 Vinylacetic acid
625-38-7 Vinylacetic acid
| product Name |
Vinylacetic acid |
| CAS No |
625-38-7 |
| Synonyms |
3-Butenoic acid; Vinylacetic acid, (3-Butenoic acid); but-3-enoic acid; but-3-enoate |
| Molecular Formula |
C4H5O2 |
| Molecular Weight |
85.0818 |
| InChI |
InChI=1/C4H6O2/c1-2-3-4(5)6/h2H,1,3H2,(H,5,6)/p-1 |
| EINECS |
210-892-5 |
| Molecular Structure |
|
| Melting point |
-39℃ |
| Boiling point |
170.6°C at 760 mmHg |
| Flash point |
68.2°C |
| Vapour Pressur |
0.714mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
| MSDS |
Material Safety Data Sheet
|
|
