ChemNet > CAS > 625-50-3 N-ethylacetamide
625-50-3 N-ethylacetamide
| product Name |
N-ethylacetamide |
| CAS No |
625-50-3 |
| Synonyms |
Ethylacetamide |
| Molecular Formula |
C4H9NO |
| Molecular Weight |
87.1204 |
| InChI |
InChI=1/C4H9NO/c1-3-5-4(2)6/h3H2,1-2H3,(H,5,6) |
| EINECS |
210-896-7 |
| Molecular Structure |
|
| Density |
0.866g/cm3 |
| Boiling point |
205°C at 760 mmHg |
| Refractive index |
1.397 |
| Flash point |
105.4°C |
| Vapour Pressur |
0.256mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
