ChemNet > CAS > 626-04-0 benzene-1,3-dithiol
626-04-0 benzene-1,3-dithiol
| product Name |
benzene-1,3-dithiol |
| CAS No |
626-04-0 |
| Synonyms |
1,3-Benzenedithiol; 1,3-Dimercaptobenzene~Dithioresorcinol |
| Molecular Formula |
C6H6S2 |
| Molecular Weight |
142.2418 |
| InChI |
InChI=1/C6H6S2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
| EINECS |
210-925-3 |
| Molecular Structure |
|
| Density |
1.24g/cm3 |
| Melting point |
24-25℃ |
| Boiling point |
244.3°C at 760 mmHg |
| Refractive index |
1.665 |
| Flash point |
112.7°C |
| Vapour Pressur |
0.0477mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
