ChemNet > CAS > 626-95-9 1,4-Pentanediol
626-95-9 1,4-Pentanediol
| product Name |
1,4-Pentanediol |
| CAS No |
626-95-9 |
| Synonyms |
Pentane-1,4-diol; AI3-08028 |
| Molecular Formula |
C5H12O2 |
| Molecular Weight |
104.1476 |
| InChI |
InChI=1/C5H12O2/c1-5(7)3-2-4-6/h5-7H,2-4H2,1H3 |
| EINECS |
210-973-5 |
| Molecular Structure |
|
| Density |
0.978g/cm3 |
| Boiling point |
286.8°C at 760 mmHg |
| Refractive index |
1.443 |
| Flash point |
99.1°C |
| Vapour Pressur |
0.00029mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
