ChemNet > CAS > 62642-62-0 4-(Morpholinomethyl)benzoic acid
62642-62-0 4-(Morpholinomethyl)benzoic acid
| product Name |
4-(Morpholinomethyl)benzoic acid |
| CAS No |
62642-62-0 |
| Synonyms |
4-(morpholin-4-ylmethyl)benzoic acid |
| Molecular Formula |
C12H15NO3 |
| Molecular Weight |
221.2524 |
| InChI |
InChI=1/C12H15NO3/c14-12(15)11-3-1-10(2-4-11)9-13-5-7-16-8-6-13/h1-4H,5-9H2,(H,14,15) |
| Molecular Structure |
|
| Density |
1.233g/cm3 |
| Melting point |
179℃ |
| Boiling point |
369.8°C at 760 mmHg |
| Refractive index |
1.58 |
| Flash point |
177.4°C |
| Vapour Pressur |
4.02E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
