ChemNet > CAS > 627-95-2 5-Aminovaleric acid hydrochloride
627-95-2 5-Aminovaleric acid hydrochloride
| product Name |
5-Aminovaleric acid hydrochloride |
| CAS No |
627-95-2 |
| Synonyms |
4-carboxybutylammonium chloride; 5-Aminopentanoic acid hydrochloride; 5-aminopentanoic acid; 5-aminopentanoic acid hydrochloride (1:1) |
| Molecular Formula |
C5H12ClNO2 |
| Molecular Weight |
153.6073 |
| InChI |
InChI=1/C5H11NO2.ClH/c6-4-2-1-3-5(7)8;/h1-4,6H2,(H,7,8);1H |
| EINECS |
211-021-1 |
| Molecular Structure |
|
| Melting point |
95-99℃ |
| Boiling point |
247.5°C at 760 mmHg |
| Flash point |
103.5°C |
| Vapour Pressur |
0.00825mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
