ChemNet > CAS > 6276-04-6 1-iodo-3,5-dinitrobenzene
6276-04-6 1-iodo-3,5-dinitrobenzene
| product Name |
1-iodo-3,5-dinitrobenzene |
| CAS No |
6276-04-6 |
| Molecular Formula |
C6H3IN2O4 |
| Molecular Weight |
294.0035 |
| InChI |
InChI=1/C6H3IN2O4/c7-4-1-5(8(10)11)3-6(2-4)9(12)13/h1-3H |
| Molecular Structure |
|
| Density |
2.174g/cm3 |
| Melting point |
108-111℃ |
| Boiling point |
346°C at 760 mmHg |
| Refractive index |
1.699 |
| Flash point |
163.1°C |
| Vapour Pressur |
0.000118mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R42/43:May cause sensitization by inhalation and skin contact.;
|
| Safety Description |
S22:Do not inhale dust.;
S24:Avoid contact with skin.;
S37:Wear suitable gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
