ChemNet > CAS > 628-99-9 2-Nonanol
628-99-9 2-Nonanol
| product Name |
2-Nonanol |
| CAS No |
628-99-9 |
| Synonyms |
n-Heptyl methyl carbinol; nonan-2-ol |
| Molecular Formula |
C9H20O |
| Molecular Weight |
144.2545 |
| InChI |
InChI=1/C9H20O/c1-3-4-5-6-7-8-9(2)10/h9-10H,3-8H2,1-2H3 |
| EINECS |
211-065-1 |
| Molecular Structure |
|
| Density |
0.824g/cm3 |
| Melting point |
-36℃ |
| Boiling point |
195.5°C at 760 mmHg |
| Refractive index |
1.43 |
| Flash point |
82.2°C |
| Vapour Pressur |
0.108mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
