6282-00-4 NN-Dipropylformamide
product Name |
NN-Dipropylformamide |
CAS No |
6282-00-4 |
Synonyms |
N,N-Di-n-propylformamide; N,N-dipropylformamide |
Molecular Formula |
C7H15NO |
Molecular Weight |
129.2001 |
InChI |
InChI=1/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
Molecular Structure |
|
Density |
0.869g/cm3 |
Boiling point |
221.3°C at 760 mmHg |
Refractive index |
1.429 |
Flash point |
83.7°C |
Vapour Pressur |
0.108mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|