ChemNet > CAS > 6282-00-4 NN-Dipropylformamide
6282-00-4 NN-Dipropylformamide
| product Name |
NN-Dipropylformamide |
| CAS No |
6282-00-4 |
| Synonyms |
N,N-Di-n-propylformamide; N,N-dipropylformamide |
| Molecular Formula |
C7H15NO |
| Molecular Weight |
129.2001 |
| InChI |
InChI=1/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
| Molecular Structure |
|
| Density |
0.869g/cm3 |
| Boiling point |
221.3°C at 760 mmHg |
| Refractive index |
1.429 |
| Flash point |
83.7°C |
| Vapour Pressur |
0.108mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
