62936-23-6 5-Chlorovanillic acid
product Name |
5-Chlorovanillic acid |
CAS No |
62936-23-6 |
Synonyms |
5-Chlorovanilic acid; 5-Chloro-4-hydroxy-3-methoxybenzoic acid; 3-chloro-4-hydroxy-5-methoxybenzoic acid |
Molecular Formula |
C8H7ClO4 |
Molecular Weight |
202.5918 |
InChI |
InChI=1/C8H7ClO4/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,10H,1H3,(H,11,12) |
EINECS |
263-766-7 |
Molecular Structure |
|
Density |
1.485g/cm3 |
Melting point |
241-243℃ |
Boiling point |
352.3°C at 760 mmHg |
Refractive index |
1.599 |
Flash point |
166.9°C |
Vapour Pressur |
1.44E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|