ChemNet > CAS > 6296-99-7 Diethyl aminomethylenemalonate
6296-99-7 Diethyl aminomethylenemalonate
| product Name |
Diethyl aminomethylenemalonate |
| CAS No |
6296-99-7 |
| Synonyms |
Aminomethylenemalonic acid diethyl ester; Diethyl(aminomethylene)malonate; diethyl (aminomethylidene)propanedioate; Diethyl 2-(aminomethylene)malonate |
| Molecular Formula |
C8H13NO4 |
| Molecular Weight |
187.1931 |
| InChI |
InChI=1/C8H13NO4/c1-3-12-7(10)6(5-9)8(11)13-4-2/h5H,3-4,9H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.136g/cm3 |
| Boiling point |
263.4°C at 760 mmHg |
| Refractive index |
1.471 |
| Flash point |
105.3°C |
| Vapour Pressur |
0.0103mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R43:May cause sensitization by skin contact.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
