ChemNet > CAS > 6304-16-1 (4-Pyridyl)acetone
6304-16-1 (4-Pyridyl)acetone
| product Name |
(4-Pyridyl)acetone |
| CAS No |
6304-16-1 |
| Synonyms |
1-(4-Pyridyl)-2-propanone; 1-(pyridin-4-yl)propan-2-one; 1-(4-Pyridyl)-2-acetone; 1-(4-Pyridyl)acetone; 4-Pyridyl acetone |
| Molecular Formula |
C8H9NO |
| Molecular Weight |
135.1632 |
| InChI |
InChI=1/C8H9NO/c1-7(10)6-8-2-4-9-5-3-8/h2-5H,6H2,1H3 |
| EINECS |
228-605-7 |
| Molecular Structure |
|
| Density |
1.047g/cm3 |
| Boiling point |
232.523°C at 760 mmHg |
| Refractive index |
1.509 |
| Flash point |
100.06°C |
| Vapour Pressur |
0.059mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
