ChemNet > CAS > 6306-07-6 1-Acenaphthenol
6306-07-6 1-Acenaphthenol
| product Name |
1-Acenaphthenol |
| CAS No |
6306-07-6 |
| Molecular Formula |
C12H10O |
| Molecular Weight |
170.2072 |
| InChI |
InChI=1/C12H10O/c13-11-7-9-5-1-3-8-4-2-6-10(11)12(8)9/h1-6,11,13H,7H2/t11-/m1/s1 |
| EINECS |
228-618-8 |
| Molecular Structure |
|
| Density |
1.29g/cm3 |
| Melting point |
147-148℃ |
| Boiling point |
369.2°C at 760 mmHg |
| Refractive index |
1.741 |
| Flash point |
129°C |
| Vapour Pressur |
4.2E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
