ChemNet > CAS > 632-22-4 1,1,3,3-Tetramethylurea
632-22-4 1,1,3,3-Tetramethylurea
| product Name |
1,1,3,3-Tetramethylurea |
| CAS No |
632-22-4 |
| Synonyms |
Tetramethylurea |
| Molecular Formula |
C5H12N2O |
| Molecular Weight |
116.16 |
| InChI |
InChI=1/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3 |
| EINECS |
211-173-9 |
| Molecular Structure |
|
| Density |
0.9879 |
| Melting point |
-1℃ |
| Boiling point |
174-178℃ |
| Refractive index |
1.4496-1.4516 |
| Flash point |
65℃ |
| Water solubility |
miscible |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
| MSDS |
Material Safety Data Sheet
|
|
