ChemNet > CAS > 6320-40-7 2,4,6-Tribromotoluene
6320-40-7 2,4,6-Tribromotoluene
| product Name |
2,4,6-Tribromotoluene |
| CAS No |
6320-40-7 |
| Synonyms |
1,3,5-tribromo-2-methylbenzene |
| Molecular Formula |
C7H5Br3 |
| Molecular Weight |
328.8266 |
| InChI |
InChI=1/C7H5Br3/c1-4-6(9)2-5(8)3-7(4)10/h2-3H,1H3 |
| EINECS |
228-672-2 |
| Molecular Structure |
|
| Density |
2.131g/cm3 |
| Boiling point |
290.7°C at 760 mmHg |
| Refractive index |
1.619 |
| Flash point |
127.6°C |
| Vapour Pressur |
0.00356mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
