ChemNet > CAS > 6321-11-5 6-Aminothymol hydrochloride
6321-11-5 6-Aminothymol hydrochloride
| product Name |
6-Aminothymol hydrochloride |
| CAS No |
6321-11-5 |
| Synonyms |
4-Amino-2-isopropyl-5-methylphenol hydrochloride; 4-amino-5-methyl-2-(propan-2-yl)phenol hydrochloride (1:1) |
| Molecular Formula |
C10H16ClNO |
| Molecular Weight |
201.6931 |
| InChI |
InChI=1/C10H15NO.ClH/c1-6(2)8-5-9(11)7(3)4-10(8)12;/h4-6,12H,11H2,1-3H3;1H |
| Molecular Structure |
|
| Boiling point |
304.6°C at 760 mmHg |
| Flash point |
138°C |
| Vapour Pressur |
0.000481mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
