ChemNet > CAS > 6324-11-4 (2-hydroxyphenoxy)acetic acid
6324-11-4 (2-hydroxyphenoxy)acetic acid
| product Name |
(2-hydroxyphenoxy)acetic acid |
| CAS No |
6324-11-4 |
| Synonyms |
2-Hydroxyphenoxyacetic acid |
| Molecular Formula |
C8H8O4 |
| Molecular Weight |
168.1467 |
| InChI |
InChI=1/C8H8O4/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4,9H,5H2,(H,10,11) |
| EINECS |
228-684-8 |
| Molecular Structure |
|
| Density |
1.367g/cm3 |
| Melting point |
138-141℃ |
| Boiling point |
339.6°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
143°C |
| Vapour Pressur |
3.52E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
