ChemNet > CAS > 6326-14-3 2,4-Dichlorophenylthiourae
6326-14-3 2,4-Dichlorophenylthiourae
| product Name |
2,4-Dichlorophenylthiourae |
| CAS No |
6326-14-3 |
| Molecular Formula |
C7H6Cl2N2S |
| Molecular Weight |
221.1069 |
| InChI |
InChI=1/C7H6Cl2N2S/c8-4-1-2-6(5(9)3-4)11-7(10)12/h1-3H,(H3,10,11,12) |
| Molecular Structure |
|
| Density |
1.563g/cm3 |
| Boiling point |
321.8°C at 760 mmHg |
| Refractive index |
1.73 |
| Flash point |
148.4°C |
| Vapour Pressur |
0.000292mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
