ChemNet > CAS > 6326-44-9 Diethyl formamidomalonate
6326-44-9 Diethyl formamidomalonate
| product Name |
Diethyl formamidomalonate |
| CAS No |
6326-44-9 |
| Synonyms |
Formamidomalonic acid diethyl ester; diethyl (formylamino)propanedioate; Diethylformamidomalonate |
| Molecular Formula |
C8H13NO5 |
| Molecular Weight |
203.1925 |
| InChI |
InChI=1/C8H13NO5/c1-3-13-7(11)6(9-5-10)8(12)14-4-2/h5-6H,3-4H2,1-2H3,(H,9,10) |
| EINECS |
228-692-1 |
| Molecular Structure |
|
| Density |
1.167g/cm3 |
| Melting point |
51-56℃ |
| Boiling point |
316.8°C at 760 mmHg |
| Refractive index |
1.445 |
| Flash point |
165.7°C |
| Vapour Pressur |
0.0004mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
