ChemNet > CAS > 6336-58-9 3-Dibutylamino-1-propyne
6336-58-9 3-Dibutylamino-1-propyne
| product Name |
3-Dibutylamino-1-propyne |
| CAS No |
6336-58-9 |
| Synonyms |
N-butyl-N-(prop-2-yn-1-yl)butan-1-amine |
| Molecular Formula |
C11H21N |
| Molecular Weight |
167.2911 |
| InChI |
InChI=1/C11H21N/c1-4-7-10-12(9-6-3)11-8-5-2/h3H,4-5,7-11H2,1-2H3 |
| Molecular Structure |
|
| Density |
0.831g/cm3 |
| Boiling point |
224.4°C at 760 mmHg |
| Refractive index |
1.454 |
| Flash point |
81.4°C |
| Vapour Pressur |
0.0913mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
