ChemNet > CAS > 63417-81-2 5-(chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole
63417-81-2 5-(chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole
| product Name |
5-(chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole |
| CAS No |
63417-81-2 |
| Synonyms |
5-(chloromethyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole |
| Molecular Formula |
C7H5ClN2OS |
| Molecular Weight |
200.6454 |
| InChI |
InChI=1/C7H5ClN2OS/c8-4-6-9-7(10-11-6)5-2-1-3-12-5/h1-3H,4H2 |
| Molecular Structure |
|
| Density |
1.421g/cm3 |
| Melting point |
59℃ |
| Boiling point |
331.3°C at 760 mmHg |
| Refractive index |
1.587 |
| Flash point |
154.1°C |
| Vapour Pressur |
0.000303mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
