ChemNet > CAS > 6344-60-1 1-Hydroxy-9-fluorenone
6344-60-1 1-Hydroxy-9-fluorenone
| product Name |
1-Hydroxy-9-fluorenone |
| CAS No |
6344-60-1 |
| Synonyms |
1-Hydroxyfluoren-9-one; 1-hydroxy-9H-fluoren-9-one |
| Molecular Formula |
C13H8O2 |
| Molecular Weight |
196.2014 |
| InChI |
InChI=1/C13H8O2/c14-11-7-3-6-9-8-4-1-2-5-10(8)13(15)12(9)11/h1-7,14H |
| EINECS |
228-746-4 |
| Molecular Structure |
|
| Density |
1.369g/cm3 |
| Melting point |
116-119℃ |
| Boiling point |
383.4°C at 760 mmHg |
| Refractive index |
1.707 |
| Flash point |
163.7°C |
| Vapour Pressur |
2E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
